CAS 898765-74-7
:1-(2-chlorophenyl)-2,2-dimethyl-butan-1-one
Description:
1-(2-Chlorophenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-74-7, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a butanone backbone with a chlorophenyl group at one end and two methyl groups at the second carbon, contributing to its unique structural properties. It is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. The presence of the chlorophenyl moiety may impart specific reactivity and biological activity, making it of interest in various chemical applications, including synthesis and potential pharmaceutical development. Its physical and chemical properties, such as boiling point, melting point, and density, can vary based on purity and environmental conditions. Safety data should be consulted for handling, as it may pose risks typical of chlorinated organic compounds, including potential toxicity and environmental impact. Overall, this compound represents a class of ketones that can be utilized in diverse chemical processes.
Formula:C12H15ClO
InChI:InChI=1/C12H15ClO/c1-4-12(2,3)11(14)9-7-5-6-8-10(9)13/h5-8H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.