CAS 898765-75-8
:8-(3-chlorophenyl)-8-oxo-octanoic acid
Description:
8-(3-chlorophenyl)-8-oxo-octanoic acid, identified by its CAS number 898765-75-8, is a synthetic organic compound characterized by its unique structure, which includes a chlorophenyl group and a carboxylic acid functional group. This compound features an octanoic acid backbone, which contributes to its hydrophobic properties, while the presence of the 3-chlorophenyl moiety introduces additional polarity and potential for biological activity. The oxo group at the 8-position enhances its reactivity and may influence its interactions in biological systems. Typically, compounds of this nature may exhibit properties such as antimicrobial or anti-inflammatory activities, making them of interest in pharmaceutical research. The specific characteristics, such as solubility, melting point, and stability, would depend on the compound's molecular interactions and the environment in which it is studied. As with many organic acids, it may also participate in various chemical reactions, including esterification and amidation, which are relevant in synthetic organic chemistry.
Formula:C14H17ClO3
InChI:InChI=1/C14H17ClO3/c15-12-7-5-6-11(10-12)13(16)8-3-1-2-4-9-14(17)18/h5-7,10H,1-4,8-9H2,(H,17,18)
SMILES:C(CCCC(=O)O)CCC(=O)c1cccc(c1)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.