CAS 898765-84-9

1-(4-Bromo-2-fluorophenyl)-2,2-dimethyl-1-butanone

Description:

1-(4-Bromo-2-fluorophenyl)-2,2-dimethyl-1-butanone is an organic compound characterized by its unique structure, which includes a ketone functional group and a substituted aromatic ring. The presence of a bromine and a fluorine atom on the phenyl ring contributes to its reactivity and potential applications in various chemical reactions, including electrophilic aromatic substitution. The bulky 2,2-dimethyl group enhances steric hindrance, which can influence the compound's physical properties, such as boiling point and solubility. This compound may exhibit interesting biological activities due to its halogenated aromatic structure, making it a candidate for further research in medicinal chemistry. Additionally, its molecular structure suggests potential uses in the synthesis of more complex organic molecules. As with many halogenated compounds, it is essential to handle this substance with care, considering the environmental and health implications associated with bromine and fluorine. Overall, 1-(4-Bromo-2-fluorophenyl)-2,2-dimethyl-1-butanone represents a valuable compound in the field of organic synthesis and materials science.

Formula: C₁₂H₁₄BrFO

InChI: InChI=1S/C12H14BrFO/c1-4-12(2,3)11(15)9-6-5-8(13)7-10(9)14/h5-7H,4H2,1-3H3

InChI key: InChIKey=HFKRLLMBHOXVMK-UHFFFAOYSA-N

SMILES: C(C(CC)(C)C)(=O)C1=C(F)C=C(Br)C=C1

Synonyms:

• 1-(4-Bromo-2-fluorophenyl)-2,2-dimethyl-1-butanone
• 1-Butanone, 1-(4-bromo-2-fluorophenyl)-2,2-dimethyl-