CymitQuimica logo

CAS 898765-86-1

:

1-(2-chloro-4-fluoro-phenyl)-2,2-dimethyl-butan-1-one

Description:
1-(2-Chloro-4-fluoro-phenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-86-1, is an organic compound characterized by a ketone functional group and a complex aromatic structure. This compound features a butanone backbone, which is substituted with a 2-chloro-4-fluorophenyl group, contributing to its unique chemical properties. The presence of halogen atoms, specifically chlorine and fluorine, often enhances the compound's reactivity and can influence its physical properties, such as boiling and melting points. Additionally, the dimethyl substitution on the butanone structure may affect steric hindrance and overall molecular stability. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic pathways. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens, which can pose health risks.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c1-4-12(2,3)11(15)9-6-5-8(14)7-10(9)13/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccc(cc1Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.