CAS 898765-88-3
:1-(3-chloro-5-fluoro-phenyl)-2,2-dimethyl-butan-1-one
Description:
1-(3-Chloro-5-fluoro-phenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-88-3, is an organic compound characterized by its unique structure that includes a phenyl ring substituted with chlorine and fluorine atoms, as well as a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the chloro and fluoro substituents can enhance its lipophilicity and may affect its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the bulky dimethyl groups contribute to steric hindrance, potentially impacting its interactions with other molecules. The compound's stability, boiling point, melting point, and solubility in various solvents would depend on its specific molecular interactions and the environment in which it is placed. Overall, this compound's unique characteristics make it a subject of interest in various chemical applications, particularly in the development of new materials or therapeutic agents.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c1-4-12(2,3)11(15)8-5-9(13)7-10(14)6-8/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.