CAS 898765-90-7
:1-(4-chloro-2-fluoro-phenyl)-2,2-dimethyl-butan-1-one
Description:
1-(4-chloro-2-fluoro-phenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-90-7, is an organic compound characterized by its unique molecular structure, which includes a ketone functional group and a substituted aromatic ring. The presence of both chlorine and fluorine atoms on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound features a bulky 2,2-dimethylbutan-1-one moiety, which may influence its physical properties such as boiling point, melting point, and solubility. Typically, compounds with such substituents exhibit interesting biological activities, making them subjects of interest in medicinal chemistry. Additionally, the presence of halogens can enhance lipophilicity, potentially affecting the compound's interaction with biological membranes. Safety and handling considerations are important, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure and substituents suggest a range of potential applications and warrant further investigation into its properties and uses.
Formula:C12H14ClFO
InChI:InChI=1/C12H14ClFO/c1-4-12(2,3)11(15)9-6-5-8(13)7-10(9)14/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccc(cc1F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.