CAS 898765-92-9
:1-(2,3-dichlorophenyl)-2,2-dimethyl-butan-1-one
Description:
1-(2,3-Dichlorophenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-92-9, is an organic compound characterized by its unique structure that includes a dichlorophenyl group and a ketone functional group. This compound typically exhibits a solid state at room temperature and is likely to be a white to off-white crystalline substance. It is expected to be relatively hydrophobic due to the presence of the bulky dimethyl and dichlorophenyl groups, which may influence its solubility in various organic solvents. The dichlorophenyl moiety may impart specific reactivity patterns, making it of interest in synthetic organic chemistry and potentially in pharmaceutical applications. Additionally, the compound's ketone functional group suggests it may participate in various chemical reactions, such as nucleophilic additions or reductions. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structural features contribute to its potential utility in various chemical applications.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c1-4-12(2,3)11(15)8-6-5-7-9(13)10(8)14/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1cccc(c1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.