CAS 898765-94-1

1-(2,4-Dichlorophenyl)-2,2-dimethyl-1-butanone

Description:

1-(2,4-Dichlorophenyl)-2,2-dimethyl-1-butanone, identified by its CAS number 898765-94-1, is an organic compound characterized by its unique structure, which includes a dichlorophenyl group and a ketone functional group. This compound typically exhibits a moderate to high molecular weight and is likely to be a solid or viscous liquid at room temperature, depending on its specific formulation and purity. The presence of the dichlorophenyl moiety suggests potential applications in agrochemicals or pharmaceuticals, as chlorinated aromatic compounds often exhibit significant biological activity. Additionally, the bulky dimethyl groups may influence its steric properties, affecting its reactivity and interactions with other molecules. The compound's solubility characteristics would depend on the solvent used, with potential solubility in organic solvents but limited solubility in water due to its hydrophobic nature. Safety data should be consulted for handling and exposure guidelines, as chlorinated compounds can pose environmental and health risks. Overall, this compound's unique structure and properties make it of interest in various chemical research and industrial applications.

Formula: C₁₂H₁₄Cl₂O

InChI: InChI=1S/C12H14Cl2O/c1-4-12(2,3)11(15)9-6-5-8(13)7-10(9)14/h5-7H,4H2,1-3H3

InChI key: InChIKey=DNLPDLSLKAZZRH-UHFFFAOYSA-N

SMILES: C(C(CC)(C)C)(=O)C1=C(Cl)C=C(Cl)C=C1

Synonyms:

• 1-Butanone, 1-(2,4-dichlorophenyl)-2,2-dimethyl-
• 1-(2,4-Dichlorophenyl)-2,2-dimethyl-1-butanone