CAS 898765-98-5
:1-(3,4-dichlorophenyl)-2,2-dimethyl-butan-1-one
Description:
1-(3,4-Dichlorophenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898765-98-5, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a dichlorophenyl group, which contributes to its potential biological activity and chemical reactivity. The presence of two methyl groups on the butanone backbone enhances its steric hindrance, influencing its physical properties such as boiling point and solubility. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the aromatic ring, affecting their behavior in biological systems and their interaction with other substances. Additionally, the dichlorophenyl moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. Safety data and handling precautions should be considered, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals, warranting further investigation into its properties and uses.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c1-4-12(2,3)11(15)8-5-6-9(13)10(14)7-8/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccc(c(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.