CAS 898766-00-2
:1-(3,5-dichlorophenyl)-2,2-dimethyl-butan-1-one
Description:
1-(3,5-Dichlorophenyl)-2,2-dimethyl-butan-1-one, identified by its CAS number 898766-00-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a dichlorophenyl group, which contributes to its chemical stability and potential reactivity, particularly in electrophilic substitution reactions. The presence of the bulky 2,2-dimethyl group enhances its steric hindrance, influencing its physical properties such as boiling and melting points. Typically, compounds of this nature exhibit moderate solubility in organic solvents and low solubility in water due to their hydrophobic characteristics. Additionally, the dichlorophenyl moiety may impart specific biological activities, making this compound of interest in pharmaceutical and agrochemical research. Safety data should be consulted for handling and exposure risks, as halogenated compounds can exhibit varying degrees of toxicity and environmental impact. Overall, this compound's unique structure suggests potential applications in synthetic organic chemistry and material science.
Formula:C12H14Cl2O
InChI:InChI=1/C12H14Cl2O/c1-4-12(2,3)11(15)8-5-9(13)7-10(14)6-8/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.