CAS 898766-02-4

1-(2,4-Difluorophenyl)-2,2-dimethyl-1-butanone

Description:

1-(2,4-Difluorophenyl)-2,2-dimethyl-1-butanone, with the CAS number 898766-02-4, is an organic compound characterized by its unique structure, which includes a difluorophenyl group and a ketone functional group. This compound typically exhibits a moderate molecular weight and is likely to be a colorless to pale yellow liquid at room temperature. Its chemical properties suggest it may be relatively stable under standard conditions, but it could be sensitive to strong oxidizing agents. The presence of the difluorophenyl moiety may impart specific electronic and steric effects, influencing its reactivity and interactions with other substances. Additionally, the bulky dimethyl groups contribute to its steric hindrance, potentially affecting its solubility and volatility. This compound may find applications in various fields, including pharmaceuticals and agrochemicals, due to its unique structural features. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₁₂H₁₄F₂O

InChI: InChI=1S/C12H14F2O/c1-4-12(2,3)11(15)9-6-5-8(13)7-10(9)14/h5-7H,4H2,1-3H3

InChI key: InChIKey=DTQYYVCQDVBTLI-UHFFFAOYSA-N

SMILES: C(C(CC)(C)C)(=O)C1=C(F)C=C(F)C=C1

Synonyms:

• 1-Butanone, 1-(2,4-difluorophenyl)-2,2-dimethyl-
• 1-(2,4-Difluorophenyl)-2,2-dimethyl-1-butanone