CymitQuimica logo

CAS 898766-04-6

:

1-(3,4-difluorophenyl)-2,2-dimethyl-butan-1-one

Description:
1-(3,4-Difluorophenyl)-2,2-dimethyl-butan-1-one, with the CAS number 898766-04-6, is an organic compound characterized by its unique structure, which includes a ketone functional group and a difluorophenyl substituent. This compound typically exhibits a relatively low melting point and moderate boiling point, indicative of its organic nature. The presence of fluorine atoms in the phenyl ring can enhance its lipophilicity and influence its reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The dimethyl substitution on the butanone backbone contributes to steric hindrance, which may affect its interaction with biological targets. Additionally, the compound's molecular structure suggests potential for diverse chemical reactivity, including electrophilic aromatic substitution and nucleophilic addition reactions. Safety data should be consulted for handling, as the presence of fluorine can impart specific hazards. Overall, this compound represents a valuable entity for research and development in synthetic organic chemistry.
Formula:C12H14F2O
InChI:InChI=1/C12H14F2O/c1-4-12(2,3)11(15)8-5-6-9(13)10(14)7-8/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1ccc(c(c1)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.