CymitQuimica logo

CAS 898766-06-8

:

1-(3,5-difluorophenyl)-2,2-dimethyl-butan-1-one

Description:
1-(3,5-Difluorophenyl)-2,2-dimethyl-butan-1-one is an organic compound characterized by its unique structure, which includes a ketone functional group and a difluorophenyl substituent. The presence of the difluorophenyl group indicates that the compound may exhibit interesting electronic and steric properties, potentially influencing its reactivity and interactions with other molecules. The two methyl groups attached to the butanone backbone contribute to its steric bulk, which can affect its solubility and boiling point. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may be used in various applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Safety data should be consulted for handling, as the presence of fluorine atoms can impart unique toxicity and environmental considerations. Overall, the compound's characteristics make it a subject of interest in both academic and industrial chemistry contexts.
Formula:C12H14F2O
InChI:InChI=1/C12H14F2O/c1-4-12(2,3)11(15)8-5-9(13)7-10(14)6-8/h5-7H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1cc(cc(c1)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.