CymitQuimica logo

CAS 898766-08-0

:

2,2-dimethyl-1-(3,4,5-trifluorophenyl)butan-1-one

Description:
2,2-Dimethyl-1-(3,4,5-trifluorophenyl)butan-1-one is an organic compound characterized by its ketone functional group, which is indicated by the presence of the carbonyl (C=O) group in its structure. This compound features a branched alkyl chain with two methyl groups attached to the second carbon, contributing to its steric hindrance and potentially influencing its reactivity and physical properties. The presence of the trifluorophenyl group introduces significant electronegativity due to the three fluorine atoms, which can enhance the compound's lipophilicity and alter its electronic properties, making it useful in various chemical applications. The trifluoromethyl groups can also affect the compound's boiling point, solubility, and interaction with biological systems. Overall, 2,2-dimethyl-1-(3,4,5-trifluorophenyl)butan-1-one is a complex molecule that may exhibit unique characteristics valuable in pharmaceuticals, agrochemicals, or materials science, depending on its specific applications.
Formula:C12H13F3O
InChI:InChI=1/C12H13F3O/c1-4-12(2,3)11(16)7-5-8(13)10(15)9(14)6-7/h5-6H,4H2,1-3H3
SMILES:CCC(C)(C)C(=O)c1cc(c(c(c1)F)F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.