CAS 898766-09-1
:8-oxo-8-(9-phenanthryl)octanoic acid
Description:
8-Oxo-8-(9-phenanthryl)octanoic acid is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with an oxo group and a phenanthryl substituent. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The phenanthryl moiety contributes to its aromatic characteristics, potentially influencing its electronic properties and interactions with biological systems. The presence of the oxo group may also enhance its reactivity, making it a candidate for various chemical transformations. In terms of applications, compounds like this can be explored in medicinal chemistry, particularly for their potential biological activities, including anti-inflammatory or anticancer properties. However, specific biological activities and safety profiles would require further investigation through empirical studies. Overall, 8-oxo-8-(9-phenanthryl)octanoic acid represents a class of compounds that bridge the gap between fatty acids and aromatic systems, offering diverse possibilities for research and application.
Formula:C22H22O3
InChI:InChI=1/C22H22O3/c23-21(13-3-1-2-4-14-22(24)25)20-15-16-9-5-6-10-17(16)18-11-7-8-12-19(18)20/h5-12,15H,1-4,13-14H2,(H,24,25)
SMILES:C(CCCC(=O)O)CCC(=O)c1cc2ccccc2c2ccccc12
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.