CAS 898766-12-6
:3-(2,2-dimethylpropanoyl)benzonitrile
Description:
3-(2,2-Dimethylpropanoyl)benzonitrile is an organic compound characterized by its unique structure, which includes a benzonitrile moiety and a 2,2-dimethylpropanoyl group. This compound features a benzene ring substituted with a nitrile group (-C≡N) and an acyl group derived from 2,2-dimethylpropanoic acid. The presence of the nitrile group imparts certain polar characteristics, making the compound relatively soluble in polar solvents. The bulky 2,2-dimethylpropanoyl group contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical research. Additionally, its synthesis and characterization can involve various organic chemistry techniques, including NMR spectroscopy and mass spectrometry, to confirm its structure and purity. Overall, 3-(2,2-dimethylpropanoyl)benzonitrile represents a complex organic molecule with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C12H13NO
InChI:InChI=1/C12H13NO/c1-12(2,3)11(14)10-6-4-5-9(7-10)8-13/h4-7H,1-3H3
SMILES:CC(C)(C)C(=O)c1cccc(c1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.