CAS 898766-14-8

[2-(thiophene-2-carbonyl)phenyl] acetate

Description:

[2-(Thiophene-2-carbonyl)phenyl] acetate, with the CAS number 898766-14-8, is an organic compound characterized by its unique structure that includes a thiophene ring and an acetate functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl and acetate moieties. The thiophene ring contributes to its electronic properties, potentially allowing for interesting interactions in various chemical environments. It may display moderate solubility in organic solvents, influenced by the hydrophobic nature of the thiophene and the polar character of the acetate group. Additionally, this compound could be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing more complex molecules. Its reactivity may include acylation and esterification reactions, making it a valuable intermediate in organic synthesis. Overall, [2-(thiophene-2-carbonyl)phenyl] acetate represents a versatile compound with applications in various chemical fields.

Formula: C₁₃H₁₀O₃S

InChI: InChI=1/C13H10O3S/c1-9(14)16-11-6-3-2-5-10(11)13(15)12-7-4-8-17-12/h2-8H,1H3

SMILES: CC(=O)Oc1ccccc1C(=O)c1cccs1

2-(2-Acetoxybenzoyl) thiophene

CAS: 898766-14-8

Formula: C₁₃H₁₀O₃S

Purity: 90.0%

Molecular weight: 246.28

Ref: 10-F202764