CymitQuimica logo

CAS 898766-16-0

:

6-(2,3-difluorophenyl)-6-oxo-hexanoic acid

Description:
6-(2,3-Difluorophenyl)-6-oxo-hexanoic acid is an organic compound characterized by its unique structure, which includes a hexanoic acid backbone with a ketone functional group and a difluorophenyl substituent. The presence of the difluorophenyl group indicates that the compound has two fluorine atoms attached to a phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. The carboxylic acid functional group contributes to its acidity and potential for hydrogen bonding, while the ketone group enhances its reactivity in various organic reactions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for pharmaceutical research. Additionally, its molecular structure suggests potential applications in materials science or as an intermediate in organic synthesis. The specific interactions and stability of this compound can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C12H12F2O3
InChI:InChI=1/C12H12F2O3/c13-9-5-3-4-8(12(9)14)10(15)6-1-2-7-11(16)17/h3-5H,1-2,6-7H2,(H,16,17)
SMILES:C(CCC(=O)O)CC(=O)c1cccc(c1F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.