CAS 898766-17-1

[2-(Acetyloxy)phenyl]-2-furanylmethanone

Description:

[2-(Acetyloxy)phenyl]-2-furanylmethanone, with the CAS number 898766-17-1, is an organic compound characterized by its unique structural features, which include a phenyl ring substituted with an acetyloxy group and a furan moiety linked to a ketone. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The acetyloxy group can enhance solubility in organic solvents and may influence the compound's reactivity in various chemical reactions, including esterification and acylation. Additionally, the furan ring contributes to the compound's aromaticity and may participate in electrophilic substitution reactions. The presence of the ketone functional group suggests potential applications in organic synthesis and medicinal chemistry, where such compounds may exhibit biological activity. Overall, [2-(Acetyloxy)phenyl]-2-furanylmethanone represents a versatile structure with potential implications in various chemical and pharmaceutical applications.

Formula: C₁₃H₁₀O₄

InChI: InChI=1S/C13H10O4/c1-9(14)17-11-6-3-2-5-10(11)13(15)12-7-4-8-16-12/h2-8H,1H3

InChI key: InChIKey=WQDATVXQSHKNRT-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C2=CC=CO2

Synonyms:

• [2-(Acetyloxy)phenyl]-2-furanylmethanone
• Methanone, [2-(acetyloxy)phenyl]-2-furanyl-

2-(2-Acetoxybenzoyl) furan

CAS: 898766-17-1

Formula: C₁₃H₁₀O₄

Purity: 90.0%

Molecular weight: 230.219

Ref: 10-F202767