CAS 898766-19-3
:2,3-Difluoro-ζ-oxobenzeneheptanoic acid
Description:
2,3-Difluoro-ζ-oxobenzeneheptanoic acid is a chemical compound characterized by the presence of a heptanoic acid backbone with a benzene ring that features two fluorine substituents at the 2 and 3 positions. This compound is likely to exhibit both hydrophilic and hydrophobic properties due to the carboxylic acid functional group and the aromatic system, which can influence its solubility in various solvents. The fluorine atoms can enhance the compound's stability and alter its reactivity, potentially affecting its interactions in biological systems or chemical reactions. The presence of the oxo group (carbonyl) contributes to its acidity and can participate in hydrogen bonding. As a synthetic compound, it may have applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on its biological activity and chemical properties. Safety data and handling precautions should be considered, as with any fluorinated compound, due to potential toxicity and environmental impact.
Formula:C13H14F2O3
InChI:InChI=1S/C13H14F2O3/c14-10-6-4-5-9(13(10)15)11(16)7-2-1-3-8-12(17)18/h4-6H,1-3,7-8H2,(H,17,18)
InChI key:InChIKey=LOABOFZZPXSXLT-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)(=O)C1=C(F)C(F)=CC=C1
Synonyms:- 2,3-Difluoro-ζ-oxobenzeneheptanoic acid
- Benzeneheptanoic acid, 2,3-difluoro-ζ-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.