CAS 898766-20-6

[3-(Acetyloxy)phenyl]-2-furanylmethanone

Description:

[3-(Acetyloxy)phenyl]-2-furanylmethanone, with the CAS number 898766-20-6, is an organic compound characterized by its unique structural features, which include a phenyl ring substituted with an acetyloxy group and a furan moiety linked to a ketone. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential reactivity in electrophilic aromatic substitution and the ability to participate in various chemical reactions due to the presence of the carbonyl group. Its molecular structure suggests it may possess biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the acetyloxy group can enhance solubility and stability, while the furan ring may contribute to its reactivity and interaction with biological targets. Additionally, compounds of this nature may exhibit fluorescence or other optical properties, which can be useful in various applications, including as dyes or in sensors. Overall, [3-(Acetyloxy)phenyl]-2-furanylmethanone represents a versatile scaffold for further chemical exploration and potential therapeutic development.

Formula: C₁₃H₁₀O₄

InChI: InChI=1S/C13H10O4/c1-9(14)17-11-5-2-4-10(8-11)13(15)12-6-3-7-16-12/h2-8H,1H3

InChI key: InChIKey=KKDXNMPGYHPJOQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(OC(C)=O)=CC=C1)C2=CC=CO2

Synonyms:

• Methanone, [3-(acetyloxy)phenyl]-2-furanyl-
• [3-(Acetyloxy)phenyl]-2-furanylmethanone

2-(3-Acetoxybenzoyl) furan

CAS: 898766-20-6

Formula: C₁₃H₁₀O₄

Purity: 90.0%

Molecular weight: 230.219

Ref: 10-F202768