CAS 898766-22-8
:8-(2,3-difluorophenyl)-8-oxo-octanoic acid
Description:
8-(2,3-Difluorophenyl)-8-oxo-octanoic acid, identified by its CAS number 898766-22-8, is a synthetic organic compound characterized by its unique molecular structure, which includes an octanoic acid backbone with a ketone functional group and a difluorophenyl substituent. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The difluorophenyl moiety may impart specific electronic and steric effects, influencing its biological activity and interactions with other molecules. As a result, it may be of interest in pharmaceutical research, particularly in the development of compounds with targeted biological effects. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it a candidate for further investigation in medicinal chemistry. However, detailed studies on its specific physical and chemical properties, as well as its biological activity, would be necessary to fully understand its potential applications.
Formula:C14H16F2O3
InChI:InChI=1/C14H16F2O3/c15-11-7-5-6-10(14(11)16)12(17)8-3-1-2-4-9-13(18)19/h5-7H,1-4,8-9H2,(H,18,19)
SMILES:C(CCCC(=O)O)CCC(=O)c1cccc(c1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.