CAS 898766-23-9

[4-(Acetyloxy)phenyl]-2-furanylmethanone

Description:

[4-(Acetyloxy)phenyl]-2-furanylmethanone, with the CAS number 898766-23-9, is an organic compound characterized by its unique structural features, which include a phenyl ring substituted with an acetyloxy group and a furan moiety linked to a ketone. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential reactivity in electrophilic aromatic substitution and the ability to participate in various chemical reactions due to the presence of the carbonyl group. It may display moderate to high solubility in organic solvents, while its solubility in water could be limited due to the hydrophobic nature of the aromatic and furan rings. The compound's functional groups suggest potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, its structural characteristics may confer specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₃H₁₀O₄

InChI: InChI=1S/C13H10O4/c1-9(14)17-11-6-4-10(5-7-11)13(15)12-3-2-8-16-12/h2-8H,1H3

InChI key: InChIKey=JWZPIVJRJIBWNL-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OC(C)=O)C=C1)C2=CC=CO2

Synonyms:

• Methanone, [4-(acetyloxy)phenyl]-2-furanyl-
• [4-(Acetyloxy)phenyl]-2-furanylmethanone

2-(4-Acetoxybenzoyl) furan

CAS: 898766-23-9

Formula: C₁₃H₁₀O₄

Purity: 90.0%

Molecular weight: 230.219

Ref: 10-F202769