CymitQuimica logo

CAS 898766-25-1

:

5-(2,4-difluorophenyl)-5-oxo-pentanoic acid

Description:
5-(2,4-Difluorophenyl)-5-oxo-pentanoic acid is an organic compound characterized by its unique structure, which includes a pentanoic acid backbone substituted with a 2,4-difluorophenyl group. This compound features a ketone functional group (the 5-oxo part) and a carboxylic acid group, which contribute to its acidic properties. The presence of fluorine atoms in the phenyl ring enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the fluorine substituents, which may affect its interactions with biological targets. Overall, 5-(2,4-difluorophenyl)-5-oxo-pentanoic acid represents a class of compounds that can be explored for various chemical and biological applications.
Formula:C11H10F2O3
InChI:InChI=1/C11H10F2O3/c12-7-4-5-8(9(13)6-7)10(14)2-1-3-11(15)16/h4-6H,1-3H2,(H,15,16)
SMILES:C(CC(=O)c1ccc(cc1F)F)CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.