CAS 898766-26-2

[2-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone

Description:

The chemical substance "[2-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone," with the CAS number 898766-26-2, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with an acetyloxy group and a pyridinyl moiety that is brominated. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the acetyloxy and carbonyl moieties. The bromine atom introduces additional characteristics, such as increased molecular weight and potential for electrophilic substitution reactions. The presence of both aromatic and heterocyclic components suggests that this compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like chromatography. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and material science.

Formula: C₁₄H₁₀BrNO₃

InChI: InChI=1S/C14H10BrNO3/c1-9(17)19-13-5-3-2-4-12(13)14(18)10-6-11(15)8-16-7-10/h2-8H,1H3

InChI key: InChIKey=QPCHNQHQNGIEFB-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(OC(C)=O)C=CC=C1)C=2C=C(Br)C=NC2

Synonyms:

• [2-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone
• Methanone, [2-(acetyloxy)phenyl](5-bromo-3-pyridinyl)-