CAS 898766-28-4

2,4-Difluoro-ζ-oxobenzeneheptanoic acid

Description:

2,4-Difluoro-ζ-oxobenzeneheptanoic acid, identified by its CAS number 898766-28-4, is a chemical compound characterized by the presence of two fluorine atoms at the 2 and 4 positions of a benzene ring, along with a heptanoic acid chain. This compound features a keto group (the oxo functional group) that contributes to its reactivity and potential applications in various chemical processes. The fluorine substituents can enhance the compound's lipophilicity and influence its biological activity, making it of interest in pharmaceutical research and development. The heptanoic acid moiety provides a hydrophobic tail, which may affect the compound's solubility and interaction with biological membranes. Overall, the unique combination of functional groups in 2,4-Difluoro-ζ-oxobenzeneheptanoic acid suggests potential utility in medicinal chemistry, agrochemicals, or materials science, although specific applications would depend on further research into its properties and behavior in various environments.

Formula: C₁₃H₁₄F₂O₃

InChI: InChI=1S/C13H14F2O3/c14-9-6-7-10(11(15)8-9)12(16)4-2-1-3-5-13(17)18/h6-8H,1-5H2,(H,17,18)

InChI key: InChIKey=XLKHOHWXKBAECJ-UHFFFAOYSA-N

SMILES: C(CCCCCC(O)=O)(=O)C1=C(F)C=C(F)C=C1

Synonyms:

• 2,4-Difluoro-ζ-oxobenzeneheptanoic acid
• Benzeneheptanoic acid, 2,4-difluoro-ζ-oxo-