CAS 898766-29-5
:[3-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone
Description:
The chemical substance "[3-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone," with the CAS number 898766-29-5, is a synthetic organic compound characterized by its complex structure, which includes a phenyl ring substituted with an acetyloxy group and a pyridine ring that features a bromine atom. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The acetyloxy group can influence the compound's solubility and reactivity, while the bromine atom may impart specific electronic properties and enhance its biological activity. The presence of multiple functional groups suggests that this compound may participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its unique structure may also contribute to specific interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and solvent used.
Formula:C14H10BrNO3
InChI:InChI=1S/C14H10BrNO3/c1-9(17)19-13-4-2-3-10(6-13)14(18)11-5-12(15)8-16-7-11/h2-8H,1H3
InChI key:InChIKey=HCSMIMIAHKNUMC-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC(C)=O)=CC=C1)C=2C=C(Br)C=NC2
Synonyms:- Methanone, [3-(acetyloxy)phenyl](5-bromo-3-pyridinyl)-
- [3-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.