CAS 898766-32-0

[4-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone

Description:

The chemical substance "[4-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone," with the CAS number 898766-32-0, is a synthetic organic compound characterized by its complex structure, which includes both aromatic and heterocyclic components. It features a phenyl ring substituted with an acetyloxy group and a pyridine ring that is brominated at the 5-position. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The acetyloxy moiety may contribute to its solubility in organic solvents and influence its biological activity. Additionally, the bromine atom can enhance the compound's reactivity in various chemical reactions, including electrophilic substitutions. Such compounds are often of interest in medicinal chemistry and drug development due to their potential pharmacological properties. Overall, the unique combination of functional groups and structural features makes this compound a candidate for further investigation in various chemical and biological applications.

Formula: C₁₄H₁₀BrNO₃

InChI: InChI=1S/C14H10BrNO3/c1-9(17)19-13-4-2-10(3-5-13)14(18)11-6-12(15)8-16-7-11/h2-8H,1H3

InChI key: InChIKey=IDAACAIGNXRNEH-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(Br)C=NC1)C2=CC=C(OC(C)=O)C=C2

Synonyms:

• [4-(Acetyloxy)phenyl](5-bromo-3-pyridinyl)methanone
• Methanone, [4-(acetyloxy)phenyl](5-bromo-3-pyridinyl)-

3-(4-Acetoxybenzoyl)-5-bromopyridine

CAS: 898766-32-0

Formula: C₁₄H₁₀BrNO₃

Purity: 90.0%

Molecular weight: 320.142

Ref: 10-F202772