CymitQuimica logo

CAS 898766-33-1

:

1-(3-chloro-4-fluoro-phenyl)-2,2-dimethyl-propan-1-one

Description:
1-(3-Chloro-4-fluoro-phenyl)-2,2-dimethyl-propan-1-one, with the CAS number 898766-33-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone substituted with a 3-chloro-4-fluorophenyl group, which contributes to its unique chemical properties. The presence of chlorine and fluorine atoms in the aromatic ring enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The dimethyl substitution on the propanone structure provides steric hindrance, which can affect the compound's interaction with biological targets. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, influencing their solubility and distribution in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents. Overall, this compound's unique structure positions it as a potential candidate for various applications in synthetic chemistry and drug development.
Formula:C11H12ClFO
InChI:InChI=1/C11H12ClFO/c1-11(2,3)10(14)7-4-5-9(13)8(12)6-7/h4-6H,1-3H3
SMILES:CC(C)(C)C(=O)c1ccc(c(c1)Cl)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.