CAS 898766-42-2

1-(4-bromo-2-fluoro-phenyl)-2,2-dimethyl-propan-1-one

Description:

1-(4-bromo-2-fluoro-phenyl)-2,2-dimethyl-propan-1-one, with the CAS number 898766-42-2, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a phenyl ring substituted with both bromine and fluorine atoms, which can influence its reactivity and physical properties. The presence of the bulky 2,2-dimethyl group contributes to its steric hindrance, potentially affecting its interactions in chemical reactions. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which can impact their solubility in various solvents. The bromine and fluorine substituents can also impart unique electronic properties, making the compound of interest in fields such as medicinal chemistry and materials science. Additionally, the compound's stability, boiling point, melting point, and reactivity would depend on the specific conditions and environment in which it is studied. Overall, this compound represents a unique structure that may have applications in various chemical research areas.

Formula: C₁₁H₁₂BrFO

InChI: InChI=1/C11H12BrFO/c1-11(2,3)10(14)8-5-4-7(12)6-9(8)13/h4-6H,1-3H3

SMILES: CC(C)(C)C(=O)c1ccc(cc1F)Br