CymitQuimica logo

CAS 898766-48-8

:

1-(3-chloro-5-fluoro-phenyl)-2,2-dimethyl-propan-1-one

Description:
1-(3-Chloro-5-fluoro-phenyl)-2,2-dimethyl-propan-1-one, with the CAS number 898766-48-8, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 3-chloro-5-fluorophenyl group, which contributes to its unique chemical properties. The presence of halogen atoms, specifically chlorine and fluorine, often enhances the compound's reactivity and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The dimethyl substitution on the propanone structure provides steric hindrance, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit specific biological activities, making it a candidate for further research in medicinal chemistry. Its physical properties, such as boiling point, melting point, and solubility, would typically be determined through experimental methods, as they can vary based on the compound's purity and environmental conditions. Overall, this compound represents a class of substituted ketones that are valuable in synthetic organic chemistry.
Formula:C11H12ClFO
InChI:InChI=1/C11H12ClFO/c1-11(2,3)10(14)7-4-8(12)6-9(13)5-7/h4-6H,1-3H3
SMILES:CC(C)(C)C(=O)c1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.