CAS 898766-52-4
:8-(2,6-difluorophenyl)-8-oxo-octanoic acid
Description:
8-(2,6-Difluorophenyl)-8-oxo-octanoic acid, identified by its CAS number 898766-52-4, is a synthetic organic compound characterized by its unique structure, which includes an octanoic acid backbone with a ketone functional group and a difluorophenyl substituent. This compound typically exhibits properties associated with both fatty acids and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The difluorophenyl moiety may impart specific electronic and steric effects, influencing its biological activity and interactions with other molecules. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making this compound of interest in medicinal chemistry. Overall, 8-(2,6-difluorophenyl)-8-oxo-octanoic acid represents a class of compounds that may exhibit diverse chemical behavior and biological activity, warranting further investigation.
Formula:C14H16F2O3
InChI:InChI=1/C14H16F2O3/c15-10-6-5-7-11(16)14(10)12(17)8-3-1-2-4-9-13(18)19/h5-7H,1-4,8-9H2,(H,18,19)
SMILES:C(CCCC(=O)O)CCC(=O)c1c(cccc1F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.