CAS 898766-57-9
:1-(2,4-dichlorophenyl)-2,2-dimethyl-propan-1-one
Description:
1-(2,4-Dichlorophenyl)-2,2-dimethyl-propan-1-one, with the CAS number 898766-57-9, is an organic compound characterized by its ketone functional group. It features a propanone backbone substituted with a 2,4-dichlorophenyl group, which contributes to its chemical properties and potential reactivity. The presence of the dichlorophenyl moiety enhances its lipophilicity, making it soluble in organic solvents while being less soluble in water. This compound may exhibit biological activity, which is often explored in pharmaceutical and agrochemical research. Its structure suggests potential applications in synthesis and as an intermediate in organic chemistry. Additionally, due to the presence of chlorine atoms, it may possess unique electronic properties that can influence its reactivity and interactions with other chemical species. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, this compound represents a specific class of ketones with distinct characteristics relevant to various fields of chemistry.
Formula:C11H12Cl2O
InChI:InChI=1/C11H12Cl2O/c1-11(2,3)10(14)8-5-4-7(12)6-9(8)13/h4-6H,1-3H3
SMILES:CC(C)(C)C(=O)c1ccc(cc1Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.