CAS 898766-63-7
:1-(3,5-dichlorophenyl)-2,2-dimethylpropan-1-one
Description:
1-(3,5-Dichlorophenyl)-2,2-dimethylpropan-1-one, with the CAS number 898766-63-7, is an organic compound characterized by its ketone functional group and a complex aromatic structure. It features a dichlorophenyl group, which contributes to its potential biological activity and lipophilicity. The presence of two methyl groups on the carbon adjacent to the carbonyl enhances its steric bulk, influencing its reactivity and interaction with biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties suggest potential applications in pharmaceuticals or as an intermediate in organic synthesis. Additionally, the dichlorophenyl moiety may impart specific electronic properties, making it of interest in materials science or agrochemical research. Safety and handling precautions are essential, as with many organic compounds, due to potential toxicity or environmental impact. Overall, this compound exemplifies the complexity and diversity of organic chemistry, with implications across various fields of study.
Formula:C11H12Cl2O
InChI:InChI=1/C11H12Cl2O/c1-11(2,3)10(14)7-4-8(12)6-9(13)5-7/h4-6H,1-3H3
SMILES:CC(C)(C)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.