CAS 898766-64-8

4-(2-methoxyphenyl)-2,2-dimethyl-4-oxo-butanoic acid

Description:

4-(2-Methoxyphenyl)-2,2-dimethyl-4-oxo-butanoic acid, identified by its CAS number 898766-64-8, is an organic compound characterized by its unique structure that includes a butanoic acid moiety with a ketone and a methoxy-substituted phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents due to its hydrophobic aromatic component. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions and may exhibit acidic behavior in solution. Additionally, the methoxy group can influence the compound's reactivity and polarity, potentially affecting its interactions in biological systems or chemical reactions. Its structural features may also confer specific biological activities, making it of interest in pharmaceutical research. Overall, this compound's characteristics, including its molecular structure and functional groups, play a crucial role in determining its chemical behavior and potential applications.

Formula: C₁₃H₁₆O₄

InChI: InChI=1/C13H16O4/c1-13(2,12(15)16)8-10(14)9-6-4-5-7-11(9)17-3/h4-7H,8H2,1-3H3,(H,15,16)

SMILES: CC(C)(CC(=O)c1ccccc1OC)C(=O)O

2,2-dimethyl-4-(2-methoxyphenyl)-4-oxobutyric acid

CAS: 898766-64-8

Formula: C₁₃H₁₆O₄

Purity: 97.0%

Molecular weight: 236.267

Ref: 10-F207223