CAS 898766-66-0
:4-(3,4-difluorophenyl)-2,2-dimethyl-4-oxo-butanoic acid
Description:
4-(3,4-Difluorophenyl)-2,2-dimethyl-4-oxo-butanoic acid is a chemical compound characterized by its unique structure, which includes a butanoic acid backbone substituted with a difluorophenyl group and additional methyl groups. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of fluorine atoms in the phenyl ring can enhance the compound's lipophilicity and biological activity, influencing its interaction with biological targets. The dimethyl and keto groups contribute to its stability and reactivity, allowing for potential transformations in synthetic pathways. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Safety and handling considerations are essential, as with any chemical substance, particularly those with fluorinated groups, which may pose unique environmental and health risks.
Formula:C12H12F2O3
InChI:InChI=1/C12H12F2O3/c1-12(2,11(16)17)6-10(15)7-3-4-8(13)9(14)5-7/h3-5H,6H2,1-2H3,(H,16,17)
SMILES:CC(C)(CC(=O)c1ccc(c(c1)F)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.