CAS 898766-68-2

4-(3,5-difluorophenyl)-2,2-dimethyl-4-oxo-butanoic acid

Description:

4-(3,5-Difluorophenyl)-2,2-dimethyl-4-oxo-butanoic acid is an organic compound characterized by its unique structure, which includes a butanoic acid backbone substituted with a difluorophenyl group and additional methyl groups. This compound features a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of fluorine atoms in the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit interesting properties such as acidity due to the carboxylic acid group, and it may participate in various chemical reactions, including esterification and acylation. Its specific characteristics, such as solubility, melting point, and stability, would depend on the conditions under which it is studied. Overall, this compound represents a class of fluorinated organic molecules that can be valuable in pharmaceuticals and agrochemicals due to their enhanced biological properties.

Formula: C₁₂H₁₂F₂O₃

InChI: InChI=1/C12H12F2O3/c1-12(2,11(16)17)6-10(15)7-3-8(13)5-9(14)4-7/h3-5H,6H2,1-2H3,(H,16,17)

SMILES: CC(C)(CC(=O)c1cc(cc(c1)F)F)C(=O)O