CAS 898766-75-1

η-Oxocyclohexaneoctanoic acid

Description:

η-Oxocyclohexaneoctanoic acid, identified by its CAS number 898766-75-1, is a chemical compound that features a cyclohexane ring substituted with an octanoic acid moiety and a ketone functional group. This compound is characterized by its unique structure, which combines cyclic and linear components, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the ketone group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the octanoic acid portion may impart certain hydrophobic properties, influencing its solubility and interaction with biological systems. The compound's specific physical and chemical properties, such as melting point, boiling point, and reactivity, would depend on its molecular structure and the arrangement of functional groups. Overall, η-Oxocyclohexaneoctanoic acid represents a versatile compound with potential utility in synthetic chemistry and related applications.

Formula: C₁₄H₂₄O₃

InChI: InChI=1/C14H24O3/c15-13(12-8-4-3-5-9-12)10-6-1-2-7-11-14(16)17/h12H,1-11H2,(H,16,17)

InChI key: InChIKey=RDRFZPRBCJRPCU-UHFFFAOYSA-N

SMILES: C(CCCCCCC(O)=O)(=O)C1CCCCC1

Synonyms:

• η-Oxocyclohexaneoctanoic acid
• 8-Cyclohexyl-8-oxooctanoic acid
• Cyclohexaneoctanoic acid, η-oxo-