CAS 898766-77-3
:ζ-Oxocyclopentaneheptanoic acid
Description:
ζ-Oxocyclopentaneheptanoic acid, identified by its CAS number 898766-77-3, is a chemical compound characterized by its unique structure that includes a cyclopentane ring and a heptanoic acid moiety. This compound features a ketone functional group (the "ζ-oxo" part) which contributes to its reactivity and potential applications in organic synthesis. The presence of both cyclic and linear components in its structure may impart interesting physical and chemical properties, such as solubility in various organic solvents and potential for hydrogen bonding. The compound's molecular framework suggests it could participate in various chemical reactions, including condensation and substitution reactions, making it a candidate for further study in medicinal chemistry or materials science. Additionally, its specific stereochemistry and functional groups may influence its biological activity, although detailed studies would be necessary to elucidate its potential uses in pharmaceuticals or other fields. Overall, ζ-Oxocyclopentaneheptanoic acid represents a complex organic molecule with diverse implications in chemical research.
Formula:C12H20O3
InChI:InChI=1S/C12H20O3/c13-11(10-6-4-5-7-10)8-2-1-3-9-12(14)15/h10H,1-9H2,(H,14,15)
InChI key:InChIKey=NCMFHVOZSIOSMD-UHFFFAOYSA-N
SMILES:C(CCCCCC(O)=O)(=O)C1CCCC1
Synonyms:- ζ-Oxocyclopentaneheptanoic acid
- Cyclopentaneheptanoic acid, ζ-oxo-
- 7-Cyclopentyl-7-oxoheptanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.