CAS 898766-81-9

ε-Oxocyclobutanehexanoic acid

Description:

ε-Oxocyclobutanehexanoic acid, identified by its CAS number 898766-81-9, is a chemical compound characterized by its unique structural features, including a cyclobutane ring and a hexanoic acid moiety. This compound typically exhibits properties associated with both cyclic and linear carboxylic acids, such as solubility in polar solvents and potential reactivity due to the presence of the carboxylic acid functional group. The cyclobutane ring contributes to its rigidity and may influence its reactivity and interaction with other molecules. As a relatively specialized compound, ε-Oxocyclobutanehexanoic acid may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where its structural attributes can be leveraged for specific biological activities. Its stability, melting point, boiling point, and other physical properties would depend on the specific conditions and purity of the sample. Overall, this compound represents an interesting area of study within organic chemistry, particularly in the context of ring strain and functional group reactivity.

Formula: C₁₀H₁₆O₃

InChI: InChI=1S/C10H16O3/c11-9(8-4-3-5-8)6-1-2-7-10(12)13/h8H,1-7H2,(H,12,13)

InChI key: InChIKey=NIRYFHPBAWKZBA-UHFFFAOYSA-N

SMILES: C(CCCCC(O)=O)(=O)C1CCC1

Synonyms:

• Cyclobutanehexanoic acid, ε-oxo-
• ε-Oxocyclobutanehexanoic acid
• 6-Cyclobutyl-6-oxohexanoic acid