CymitQuimica logo

CAS 898766-83-1

:

7-cyclobutyl-7-oxo-heptanoic acid

Description:
7-Cyclobutyl-7-oxo-heptanoic acid is an organic compound characterized by its unique structure, which includes a cyclobutyl group and a ketone functional group adjacent to a carboxylic acid. This compound features a seven-carbon chain (heptanoic acid) with a ketone at the seventh carbon, contributing to its reactivity and potential applications in organic synthesis. The presence of the cyclobutyl ring introduces strain and can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. The carboxylic acid functional group imparts acidic properties, allowing for potential interactions in biochemical systems or as a precursor in synthetic pathways. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in reactions would depend on the context of use, including potential roles in drug development or as an intermediate in chemical synthesis.
Formula:C11H18O3
InChI:InChI=1/C11H18O3/c12-10(9-5-4-6-9)7-2-1-3-8-11(13)14/h9H,1-8H2,(H,13,14)
SMILES:C(CCC(=O)C1CCC1)CCC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.