CymitQuimica logo

CAS 898766-88-6

:

7-(4-bromophenyl)-7-oxo-heptanenitrile

Description:
7-(4-Bromophenyl)-7-oxo-heptanenitrile is an organic compound characterized by its unique structure, which includes a heptane backbone with a ketone functional group and a nitrile group. The presence of the 4-bromophenyl substituent introduces significant aromatic character and influences the compound's reactivity and physical properties. This compound is likely to exhibit moderate to high lipophilicity due to the long hydrocarbon chain and the aromatic ring, which can affect its solubility in various solvents. The nitrile group contributes to its polar character, potentially allowing for hydrogen bonding interactions. Additionally, the bromine atom can impart specific electronic effects, such as increased electrophilicity, which may be relevant in synthetic applications or biological interactions. The compound's molecular structure suggests potential utility in pharmaceuticals or as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity. Safety and handling precautions should be observed, as with many halogenated organic compounds, due to potential toxicity and environmental impact.
Formula:C13H14BrNO
InChI:InChI=1/C13H14BrNO/c14-12-8-6-11(7-9-12)13(16)5-3-1-2-4-10-15/h6-9H,1-5H2
SMILES:C(CCC#N)CCC(=O)c1ccc(cc1)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.