CymitQuimica logo

CAS 898766-91-1

:

η-Oxocyclopropaneoctanoic acid

Description:
η-Oxocyclopropaneoctanoic acid, identified by its CAS number 898766-91-1, is a chemical compound characterized by a cyclopropane ring fused with an octanoic acid moiety. This structure imparts unique properties, including potential reactivity due to the strained cyclopropane ring, which can participate in various chemical reactions such as ring-opening or substitution reactions. The presence of the octanoic acid component contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. This compound may exhibit biological activity, potentially influencing lipid metabolism or serving as a precursor in synthetic organic chemistry. Its specific applications and behavior in biological systems would depend on further research, particularly in the context of medicinal chemistry or materials science. As with many specialized compounds, safety data and handling precautions should be consulted to ensure proper usage in laboratory settings.
Formula:C11H18O3
InChI:InChI=1S/C11H18O3/c12-10(9-7-8-9)5-3-1-2-4-6-11(13)14/h9H,1-8H2,(H,13,14)
InChI key:InChIKey=KQOVMVZQORRTLN-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(=O)C1CC1
Synonyms:
  • η-Oxocyclopropaneoctanoic acid
  • 8-Cyclopropyl-8-oxooctanoic acid
  • Cyclopropaneoctanoic acid, η-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.