CymitQuimica logo

CAS 898766-96-6

:

1-(3-bromophenyl)-6-chloro-hexan-1-one

Description:
1-(3-Bromophenyl)-6-chloro-hexan-1-one, with the CAS number 898766-96-6, is an organic compound characterized by its unique structure, which includes a hexanone backbone substituted with a bromophenyl group and a chlorine atom. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential hydrophobic characteristics due to the presence of the bromophenyl moiety. The bromine and chlorine substituents can influence the compound's reactivity, stability, and solubility in various solvents. It may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the halogens. Additionally, the presence of the ketone functional group suggests that it may undergo nucleophilic addition reactions. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry and material science. As with many halogenated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of toxicity and persistence in biological systems.
Formula:C12H14BrClO
InChI:InChI=1/C12H14BrClO/c13-11-6-4-5-10(9-11)12(15)7-2-1-3-8-14/h4-6,9H,1-3,7-8H2
SMILES:C(CCC(=O)c1cccc(c1)Br)CCCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.