CAS 898767-00-5

1-(4-bromophenyl)-6-chloro-hexan-1-one

Description:

1-(4-bromophenyl)-6-chloro-hexan-1-one, with the CAS number 898767-00-5, is an organic compound characterized by its structure, which includes a hexanone backbone substituted with a bromophenyl group and a chlorine atom. This compound typically exhibits a white to off-white crystalline appearance. It is likely to be soluble in organic solvents such as dichloromethane and ethanol, but may have limited solubility in water due to its hydrophobic aromatic and aliphatic components. The presence of the bromine and chlorine substituents suggests that it may exhibit interesting reactivity, potentially participating in electrophilic aromatic substitution or nucleophilic reactions. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, given the functional groups present. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound represents a unique structure with potential utility in various chemical applications.

Formula: C₁₂H₁₄BrClO

InChI: InChI=1/C12H14BrClO/c13-11-7-5-10(6-8-11)12(15)4-2-1-3-9-14/h5-8H,1-4,9H2

SMILES: C(CCC(=O)c1ccc(cc1)Br)CCCl