CymitQuimica logo

CAS 898767-03-8

:

4-(1,3-Dioxolan-2-ylmethyl)benzoic acid

Description:
4-(1,3-Dioxolan-2-ylmethyl)benzoic acid is an organic compound characterized by the presence of a benzoic acid moiety and a dioxolane ring. The dioxolane group contributes to its potential as a versatile building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound typically exhibits moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. Its structure suggests that it may have interesting reactivity patterns, particularly in nucleophilic substitution reactions or as a ligand in coordination chemistry. The presence of the dioxolane ring may also impart unique properties such as increased stability or altered electronic characteristics compared to similar compounds. Additionally, the compound's potential applications could extend to materials science, where it may serve as a precursor for polymer synthesis or as an additive in various formulations. Overall, 4-(1,3-Dioxolan-2-ylmethyl)benzoic acid represents a compound of interest for further research and development in multiple chemical domains.
Formula:C11H12O4
InChI:InChI=1S/C11H12O4/c12-11(13)9-3-1-8(2-4-9)7-10-14-5-6-15-10/h1-4,10H,5-7H2,(H,12,13)
InChI key:InChIKey=GEYOEVKPCAOMEN-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C(O)=O)C=C1)C2OCCO2
Synonyms:
  • Benzoic acid, 4-(1,3-dioxolan-2-ylmethyl)-
  • 4-[(1,3-Dioxolan-2-yl)methyl]benzoic acid
  • 4-(1,3-Dioxolan-2-ylmethyl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.