CymitQuimica logo

CAS 898767-06-1

:

4-Fluoro-δ-oxobenzenepentanenitrile

Description:
4-Fluoro-δ-oxobenzenepentanenitrile, identified by its CAS number 898767-06-1, is a chemical compound that features a fluorine atom, a nitrile group, and a ketone functional group within its structure. This compound is characterized by its aromatic ring, which contributes to its stability and reactivity. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The nitrile group (-C≡N) is known for its ability to participate in various chemical reactions, including hydrolysis and reduction, making it a versatile building block in organic synthesis. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds often exhibit improved biological activity. Its physical properties, such as solubility and melting point, would depend on the specific interactions between its functional groups and the solvent environment. Overall, 4-Fluoro-δ-oxobenzenepentanenitrile represents a unique compound with potential utility in various chemical applications.
Formula:C11H10FNO
InChI:InChI=1S/C11H10FNO/c12-10-6-4-9(5-7-10)11(14)3-1-2-8-13/h4-7H,1-3H2
InChI key:InChIKey=CDGYAXKSYRIFEX-UHFFFAOYSA-N
SMILES:C(CCCC#N)(=O)C1=CC=C(F)C=C1
Synonyms:
  • 5-(4-Fluorophenyl)-5-oxopentanenitrile
  • Benzenepentanenitrile, 4-fluoro-δ-oxo-
  • 4-Fluoro-δ-oxobenzenepentanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.