CAS 898767-11-8

1-Propanone, 1-(2,5-dimethylphenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(2,5-dimethylphenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898767-11-8, is an organic compound characterized by its ketone functional group, which features a carbonyl group (C=O) bonded to two hydrocarbon groups. This compound has a complex structure that includes a propanone backbone with two aromatic substituents: a 2,5-dimethylphenyl group and a 3-fluorophenyl group. The presence of the fluorine atom in the 3-position of the phenyl ring can influence the compound's reactivity and physical properties, such as polarity and solubility. Generally, compounds of this nature may exhibit moderate volatility and can be soluble in organic solvents. They may also participate in various chemical reactions typical of ketones, including nucleophilic addition and oxidation. The specific characteristics, such as boiling point, melting point, and reactivity, would depend on the precise molecular structure and substituent effects, which can significantly influence the compound's behavior in chemical processes and applications.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-6-7-13(2)16(10-12)17(19)9-8-14-4-3-5-15(18)11-14/h3-7,10-11H,8-9H2,1-2H3

InChI key: InChIKey=DDRFGRWPQXZEIZ-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=C(C)C=CC(C)=C2

Synonyms:

• 1-Propanone, 1-(2,5-dimethylphenyl)-3-(3-fluorophenyl)-
• 2′,5′-Dimethyl-3-(3-fluorophenyl)propiophenone

2′,5′-dimethyl-3-(3-fluorophenyl)propiophenone

CAS: 898767-11-8

Formula: C₁₇H₁₇FO

Purity: 97.0%

Molecular weight: 256.32

Ref: 10-F206276