CAS 898767-20-9

1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-fluorophenyl)-

Description:

1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-fluorophenyl)-, also known by its CAS number 898767-20-9, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 3,5-dimethylphenyl group and a 3-fluorophenyl group. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its physical characteristics. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the aromatic rings, which can affect their solubility in various solvents. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, given the presence of both electron-donating and electron-withdrawing groups. Additionally, the compound may exhibit interesting biological activities, warranting further investigation in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₇H₁₇FO

InChI: InChI=1S/C17H17FO/c1-12-8-13(2)10-15(9-12)17(19)7-6-14-4-3-5-16(18)11-14/h3-5,8-11H,6-7H2,1-2H3

InChI key: InChIKey=ATHUYAOKIZBTTN-UHFFFAOYSA-N

SMILES: C(CCC1=CC(F)=CC=C1)(=O)C2=CC(C)=CC(C)=C2

Synonyms:

• 1-Propanone, 1-(3,5-dimethylphenyl)-3-(3-fluorophenyl)-
• 1-(3,5-Dimethylphenyl)-3-(3-fluorophenyl)-1-propanone