CAS 898767-23-2
:1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-fluorophenyl)-
Description:
1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-fluorophenyl)-, identified by CAS number 898767-23-2, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with two distinct aromatic substituents: a 4-bromo-3-fluorophenyl group and a 3-fluorophenyl group. The presence of halogen atoms, specifically bromine and fluorine, contributes to its unique chemical reactivity and physical properties, such as increased electronegativity and potential for hydrogen bonding. The compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature, while its molecular structure may influence its boiling and melting points. Additionally, the presence of multiple fluorine atoms can enhance lipophilicity and alter the compound's biological activity, making it of interest in pharmaceutical and agrochemical research. Overall, this compound's specific characteristics, including its reactivity and solubility, are influenced by the arrangement and nature of its substituents.
Formula:C15H11BrF2O
InChI:InChI=1S/C15H11BrF2O/c16-13-6-5-11(9-14(13)18)15(19)7-4-10-2-1-3-12(17)8-10/h1-3,5-6,8-9H,4,7H2
InChI key:InChIKey=LZHQZQLRPYCLLV-UHFFFAOYSA-N
SMILES:C(CCC1=CC(F)=CC=C1)(=O)C2=CC(F)=C(Br)C=C2
Synonyms:- 4′-Bromo-3′-fluoro-3-(3-fluorophenyl)propiophenone
- 1-(4-Bromo-3-fluorophenyl)-3-(3-fluorophenyl)-1-propanone
- 1-Propanone, 1-(4-bromo-3-fluorophenyl)-3-(3-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.